C12H22F5NO2S — CID 123204712
4,4-dimethyl-3-(4,4,5,5,5-pentafluoropentylsulfonyl)pentan-1-amine (PubChem CID 123204712) has the molecular formula C12H22F5NO2S and a molecular weight of 339.37 g/mol. Its IUPAC name is 4,4-dimethyl-3-(4,4,5,5,5-pentafluoropentylsulfonyl)pentan-1-amine.
| Compound Name | 4,4-dimethyl-3-(4,4,5,5,5-pentafluoropentylsulfonyl)pentan-1-amine |
|---|---|
| PubChem CID | 123204712 |
| Molecular Formula | C12H22F5NO2S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4,4-dimethyl-3-(4,4,5,5,5-pentafluoropentylsulfonyl)pentan-1-amine |
| SMILES | CC(C)(C)C(CCN)S(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H22F5NO2S/c1-10(2,3)9(5-7-18)21(19,20)8-4-6-11(13,14)12(15,16)17/h9H,4-8,18H2,1-3H3 |
| InChIKey | QPJSBRFGEZQAAC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|