C10H16F7NO2S — CID 142791543
5,5-difluoro-3-(4,4,5,5,5-pentafluoropentylsulfonyl)pentan-1-amine (PubChem CID 142791543) has the molecular formula C10H16F7NO2S and a molecular weight of 347.30 g/mol. Its IUPAC name is 5,5-difluoro-3-(4,4,5,5,5-pentafluoropentylsulfonyl)pentan-1-amine.
| Compound Name | 5,5-difluoro-3-(4,4,5,5,5-pentafluoropentylsulfonyl)pentan-1-amine |
|---|---|
| PubChem CID | 142791543 |
| Molecular Formula | C10H16F7NO2S |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 5,5-difluoro-3-(4,4,5,5,5-pentafluoropentylsulfonyl)pentan-1-amine |
| SMILES | NCCC(CC(F)F)S(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H16F7NO2S/c11-8(12)6-7(2-4-18)21(19,20)5-1-3-9(13,14)10(15,16)17/h7-8H,1-6,18H2 |
| InChIKey | FOECYEYIZCDQSS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|