C9H10F8O4S — CID 86632846
5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid (PubChem CID 86632846) has the molecular formula C9H10F8O4S and a molecular weight of 366.23 g/mol. Its IUPAC name is 5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid.
| Compound Name | 5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid |
|---|---|
| PubChem CID | 86632846 |
| Molecular Formula | C9H10F8O4S |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid |
| SMILES | O=C(O)C(CCC(F)(F)C(F)(F)F)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C9H10F8O4S/c10-7(11,9(15,16)17)2-1-5(6(18)19)22(20,21)4-3-8(12,13)14/h5H,1-4H2,(H,18,19) |
| InChIKey | CEEMQTBJOOPRAB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|