C10H16F3O4S- — CID 150787717
2-(3,3,3-trifluoropropylsulfonyl)heptanoate (PubChem CID 150787717) has the molecular formula C10H16F3O4S- and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropylsulfonyl)heptanoate.
| Compound Name | 2-(3,3,3-trifluoropropylsulfonyl)heptanoate |
|---|---|
| PubChem CID | 150787717 |
| Molecular Formula | C10H16F3O4S- |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-(3,3,3-trifluoropropylsulfonyl)heptanoate |
| SMILES | CCCCCC(C(=O)[O-])S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H17F3O4S/c1-2-3-4-5-8(9(14)15)18(16,17)7-6-10(11,12)13/h8H,2-7H2,1H3,(H,14,15)/p-1 |
| InChIKey | KDEXTMYSUQGVKA-UHFFFAOYSA-M |
| XLogP | 1.05 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|