C9H18F3NO2S — CID 142791542
3-methyl-4-(4,4,4-trifluorobutylsulfonyl)butan-1-amine (PubChem CID 142791542) has the molecular formula C9H18F3NO2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)butan-1-amine.
| Compound Name | 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)butan-1-amine |
|---|---|
| PubChem CID | 142791542 |
| Molecular Formula | C9H18F3NO2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)butan-1-amine |
| SMILES | CC(CCN)CS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO2S/c1-8(3-5-13)7-16(14,15)6-2-4-9(10,11)12/h8H,2-7,13H2,1H3 |
| InChIKey | CQWYYMDAKKNHKW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |