C8H16F3NO2S — CID 86696846
4-(4,4,4-trifluorobutylsulfonyl)butan-1-amine (PubChem CID 86696846) has the molecular formula C8H16F3NO2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutylsulfonyl)butan-1-amine.
| Compound Name | 4-(4,4,4-trifluorobutylsulfonyl)butan-1-amine |
|---|---|
| PubChem CID | 86696846 |
| Molecular Formula | C8H16F3NO2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 4-(4,4,4-trifluorobutylsulfonyl)butan-1-amine |
| SMILES | NCCCCS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2S/c9-8(10,11)4-3-7-15(13,14)6-2-1-5-12/h1-7,12H2 |
| InChIKey | DTZFGVUUQZWRLM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|