C19H25NO4 — CID 11724263
(2R,6S,7S,11S)-17-hydroxy-7,16-dimethoxy-10-methyl-10-azatetracyclo[11.4.0.02,7.06,11]heptadeca-1(13),14,16-trien-3-one (PubChem CID 11724263) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (2R,6S,7S,11S)-17-hydroxy-7,16-dimethoxy-10-methyl-10-azatetracyclo[11.4.0.02,7.06,11]heptadeca-1(13),14,16-trien-3-one.
| Compound Name | (2R,6S,7S,11S)-17-hydroxy-7,16-dimethoxy-10-methyl-10-azatetracyclo[11.4.0.02,7.06,11]heptadeca-1(13),14,16-trien-3-one |
|---|---|
| PubChem CID | 11724263 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (2R,6S,7S,11S)-17-hydroxy-7,16-dimethoxy-10-methyl-10-azatetracyclo[11.4.0.02,7.06,11]heptadeca-1(13),14,16-trien-3-one |
| SMILES | COc1ccc2c(c1O)[C@H]1C(=O)CC[C@H]3[C@H](C2)N(C)CC[C@@]13OC |
| InChI | InChI=1S/C19H25NO4/c1-20-9-8-19(24-3)12-5-6-14(21)17(19)16-11(10-13(12)20)4-7-15(23-2)18(16)22/h4,7,12-13,17,22H,5-6,8-10H2,1-3H3/t12-,13-,17+,19-/m0/s1 |
| InChIKey | UCQIXYWZBJPQOS-BZDUDZIASA-N |
| XLogP | 2.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |