C15H19N3O4S — CID 11724627
diethyl 2-[[4-(azidomethyl)-2,5-dimethylthiophen-3-yl]methylidene]propanedioate (PubChem CID 11724627) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is diethyl 2-[[4-(azidomethyl)-2,5-dimethylthiophen-3-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[4-(azidomethyl)-2,5-dimethylthiophen-3-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 11724627 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | diethyl 2-[[4-(azidomethyl)-2,5-dimethylthiophen-3-yl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=Cc1c(C)sc(C)c1CN=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C15H19N3O4S/c1-5-21-14(19)12(15(20)22-6-2)7-11-9(3)23-10(4)13(11)8-17-18-16/h7H,5-6,8H2,1-4H3 |
| InChIKey | MDVUHZDUKLRDIJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|