C19H23N3O8S — CID 10434057
diethyl 3-(azidomethyl)-4-(3-ethoxy-2-ethoxycarbonyl-3-oxoprop-1-enyl)thiophene-2,5-dicarboxylate (PubChem CID 10434057) has the molecular formula C19H23N3O8S and a molecular weight of 453.47 g/mol. Its IUPAC name is diethyl 3-(azidomethyl)-4-(3-ethoxy-2-ethoxycarbonyl-3-oxoprop-1-enyl)thiophene-2,5-dicarboxylate.
| Compound Name | diethyl 3-(azidomethyl)-4-(3-ethoxy-2-ethoxycarbonyl-3-oxoprop-1-enyl)thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 10434057 |
| Molecular Formula | C19H23N3O8S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | diethyl 3-(azidomethyl)-4-(3-ethoxy-2-ethoxycarbonyl-3-oxoprop-1-enyl)thiophene-2,5-dicarboxylate |
| SMILES | CCOC(=O)C(=Cc1c(C(=O)OCC)sc(C(=O)OCC)c1CN=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C19H23N3O8S/c1-5-27-16(23)12(17(24)28-6-2)9-11-13(10-21-22-20)15(19(26)30-8-4)31-14(11)18(25)29-7-3/h9H,5-8,10H2,1-4H3 |
| InChIKey | LPEMHMSDAIOZHE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 153.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|