C8H7N3O2S — CID 117257824
2-(sulfanylmethyl)-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid (PubChem CID 117257824) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-(sulfanylmethyl)-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid.
| Compound Name | 2-(sulfanylmethyl)-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 117257824 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-(sulfanylmethyl)-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(CS)nn2c1 |
| InChI | InChI=1S/C8H7N3O2S/c12-8(13)5-1-2-7-9-6(4-14)10-11(7)3-5/h1-3,14H,4H2,(H,12,13) |
| InChIKey | IYRYPUBQIGLDRL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|