C11H21NO3S — CID 117258436
3-[2-(methoxymethyl)piperidin-4-yl]thiolane 1,1-dioxide (PubChem CID 117258436) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 3-[2-(methoxymethyl)piperidin-4-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[2-(methoxymethyl)piperidin-4-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117258436 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-[2-(methoxymethyl)piperidin-4-yl]thiolane 1,1-dioxide |
| SMILES | COCC1CC(C2CCS(=O)(=O)C2)CCN1 |
| InChI | InChI=1S/C11H21NO3S/c1-15-7-11-6-9(2-4-12-11)10-3-5-16(13,14)8-10/h9-12H,2-8H2,1H3 |
| InChIKey | REZSYGLBEJXAGI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |