C12H11ClF3N3O — CID 117264349
2-chloro-3-[1-(methylamino)ethyl]-7-(trifluoromethyl)quinazolin-4-one (PubChem CID 117264349) has the molecular formula C12H11ClF3N3O and a molecular weight of 305.69 g/mol. Its IUPAC name is 2-chloro-3-[1-(methylamino)ethyl]-7-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 2-chloro-3-[1-(methylamino)ethyl]-7-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 117264349 |
| Molecular Formula | C12H11ClF3N3O |
| Molecular Weight | 305.69 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-chloro-3-[1-(methylamino)ethyl]-7-(trifluoromethyl)quinazolin-4-one |
| SMILES | CNC(C)n1c(Cl)nc2cc(C(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C12H11ClF3N3O/c1-6(17-2)19-10(20)8-4-3-7(12(14,15)16)5-9(8)18-11(19)13/h3-6,17H,1-2H3 |
| InChIKey | HDSFMAKBIBIFTO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |