C21H19F4N3O2 — CID 69075578
2-fluoro-N-[4-oxo-2-propan-2-yl-7-(trifluoromethyl)quinazolin-3-yl]-2-phenylpropanamide (PubChem CID 69075578) has the molecular formula C21H19F4N3O2 and a molecular weight of 421.39 g/mol. Its IUPAC name is 2-fluoro-N-[4-oxo-2-propan-2-yl-7-(trifluoromethyl)quinazolin-3-yl]-2-phenylpropanamide.
| Compound Name | 2-fluoro-N-[4-oxo-2-propan-2-yl-7-(trifluoromethyl)quinazolin-3-yl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 69075578 |
| Molecular Formula | C21H19F4N3O2 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-fluoro-N-[4-oxo-2-propan-2-yl-7-(trifluoromethyl)quinazolin-3-yl]-2-phenylpropanamide |
| SMILES | CC(C)c1nc2cc(C(F)(F)F)ccc2c(=O)n1NC(=O)C(C)(F)c1ccccc1 |
| InChI | InChI=1S/C21H19F4N3O2/c1-12(2)17-26-16-11-14(21(23,24)25)9-10-15(16)18(29)28(17)27-19(30)20(3,22)13-7-5-4-6-8-13/h4-12H,1-3H3,(H,27,30) |
| InChIKey | BHOLSJRZWUBCQE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |