C22H16Cl2F6N6O2 — CID 161099566
2-chloro-N-methyl-3-nitro-7-(trifluoromethyl)quinolin-4-amine;2-chloro-4-N-methyl-7-(trifluoromethyl)quinoline-3,4-diamine (PubChem CID 161099566) has the molecular formula C22H16Cl2F6N6O2 and a molecular weight of 581.30 g/mol. Its IUPAC name is 2-chloro-N-methyl-3-nitro-7-(trifluoromethyl)quinolin-4-amine;2-chloro-4-N-methyl-7-(trifluoromethyl)quinoline-3,4-diamine.
| Compound Name | 2-chloro-N-methyl-3-nitro-7-(trifluoromethyl)quinolin-4-amine;2-chloro-4-N-methyl-7-(trifluoromethyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 161099566 |
| Molecular Formula | C22H16Cl2F6N6O2 |
| Molecular Weight | 581.30 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | 2-chloro-N-methyl-3-nitro-7-(trifluoromethyl)quinolin-4-amine;2-chloro-4-N-methyl-7-(trifluoromethyl)quinoline-3,4-diamine |
| SMILES | CNc1c(N)c(Cl)nc2cc(C(F)(F)F)ccc12.CNc1c([N+](=O)[O-])c(Cl)nc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C11H7ClF3N3O2.C11H9ClF3N3/c1-16-8-6-3-2-5(11(13,14)15)4-7(6)17-10(12)9(8)18(19)20;1-17-9-6-3-2-5(11(13,14)15)4-7(6)18-10(12)8(9)16/h2-4H,1H3,(H,16,17);2-4H,16H2,1H3,(H,17,18) |
| InChIKey | UIFXZSDNNVZTMP-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.30 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|