C27H14Cl3F6N5O5 — CID 161466407
2-chloro-N-(4-methoxyphenyl)-3-nitro-7-(trifluoromethyl)quinolin-4-amine;2,4-dichloro-3-nitro-7-(trifluoromethyl)quinoline (PubChem CID 161466407) has the molecular formula C27H14Cl3F6N5O5 and a molecular weight of 708.79 g/mol. Its IUPAC name is 2-chloro-N-(4-methoxyphenyl)-3-nitro-7-(trifluoromethyl)quinolin-4-amine;2,4-dichloro-3-nitro-7-(trifluoromethyl)quinoline.
| Compound Name | 2-chloro-N-(4-methoxyphenyl)-3-nitro-7-(trifluoromethyl)quinolin-4-amine;2,4-dichloro-3-nitro-7-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 161466407 |
| Molecular Formula | C27H14Cl3F6N5O5 |
| Molecular Weight | 708.79 g/mol |
| Exact Mass | 707.00 |
| IUPAC Name | 2-chloro-N-(4-methoxyphenyl)-3-nitro-7-(trifluoromethyl)quinolin-4-amine;2,4-dichloro-3-nitro-7-(trifluoromethyl)quinoline |
| SMILES | COc1ccc(Nc2c([N+](=O)[O-])c(Cl)nc3cc(C(F)(F)F)ccc23)cc1.O=[N+]([O-])c1c(Cl)nc2cc(C(F)(F)F)ccc2c1Cl |
| InChI | InChI=1S/C17H11ClF3N3O3.C10H3Cl2F3N2O2/c1-27-11-5-3-10(4-6-11)22-14-12-7-2-9(17(19,20)21)8-13(12)23-16(18)15(14)24(25)26;11-7-5-2-1-4(10(13,14)15)3-6(5)16-9(12)8(7)17(18)19/h2-8H,1H3,(H,22,23);1-3H |
| InChIKey | WCMOUIFXVRIBHF-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.79 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|