C16H9ClF3N5O5 — CID 164562775
1-(2-chloro-4-nitrophenyl)-4-(methylamino)-3-nitro-7-(trifluoromethyl)-1,8-naphthyridin-2-one (PubChem CID 164562775) has the molecular formula C16H9ClF3N5O5 and a molecular weight of 443.73 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-4-(methylamino)-3-nitro-7-(trifluoromethyl)-1,8-naphthyridin-2-one.
| Compound Name | 1-(2-chloro-4-nitrophenyl)-4-(methylamino)-3-nitro-7-(trifluoromethyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 164562775 |
| Molecular Formula | C16H9ClF3N5O5 |
| Molecular Weight | 443.73 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-4-(methylamino)-3-nitro-7-(trifluoromethyl)-1,8-naphthyridin-2-one |
| SMILES | CNc1c([N+](=O)[O-])c(=O)n(-c2ccc([N+](=O)[O-])cc2Cl)c2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C16H9ClF3N5O5/c1-21-12-8-3-5-11(16(18,19)20)22-14(8)23(15(26)13(12)25(29)30)10-4-2-7(24(27)28)6-9(10)17/h2-6,21H,1H3 |
| InChIKey | SLWYJIUUMCBIAS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|