C15H7ClF3N3O3 — CID 170551449
4-chloro-3-nitro-1-phenyl-7-(trifluoromethyl)-1,8-naphthyridin-2-one (PubChem CID 170551449) has the molecular formula C15H7ClF3N3O3 and a molecular weight of 369.69 g/mol. Its IUPAC name is 4-chloro-3-nitro-1-phenyl-7-(trifluoromethyl)-1,8-naphthyridin-2-one.
| Compound Name | 4-chloro-3-nitro-1-phenyl-7-(trifluoromethyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 170551449 |
| Molecular Formula | C15H7ClF3N3O3 |
| Molecular Weight | 369.69 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 4-chloro-3-nitro-1-phenyl-7-(trifluoromethyl)-1,8-naphthyridin-2-one |
| SMILES | O=c1c([N+](=O)[O-])c(Cl)c2ccc(C(F)(F)F)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C15H7ClF3N3O3/c16-11-9-6-7-10(15(17,18)19)20-13(9)21(8-4-2-1-3-5-8)14(23)12(11)22(24)25/h1-7H |
| InChIKey | QLQLCVRBTQBZQA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|