C15H7ClF3N5O5 — CID 164562794
4-amino-1-(2-chloro-4-nitrophenyl)-3-nitro-7-(trifluoromethyl)-1,8-naphthyridin-2-one (PubChem CID 164562794) has the molecular formula C15H7ClF3N5O5 and a molecular weight of 429.70 g/mol. Its IUPAC name is 4-amino-1-(2-chloro-4-nitrophenyl)-3-nitro-7-(trifluoromethyl)-1,8-naphthyridin-2-one.
| Compound Name | 4-amino-1-(2-chloro-4-nitrophenyl)-3-nitro-7-(trifluoromethyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 164562794 |
| Molecular Formula | C15H7ClF3N5O5 |
| Molecular Weight | 429.70 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 4-amino-1-(2-chloro-4-nitrophenyl)-3-nitro-7-(trifluoromethyl)-1,8-naphthyridin-2-one |
| SMILES | Nc1c([N+](=O)[O-])c(=O)n(-c2ccc([N+](=O)[O-])cc2Cl)c2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C15H7ClF3N5O5/c16-8-5-6(23(26)27)1-3-9(8)22-13-7(2-4-10(21-13)15(17,18)19)11(20)12(14(22)25)24(28)29/h1-5H,20H2 |
| InChIKey | BHIGUDBKPJAQMR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|