C8H13ClO4S2 — CID 117267409
(Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride (PubChem CID 117267409) has the molecular formula C8H13ClO4S2 and a molecular weight of 272.77 g/mol. Its IUPAC name is (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride.
| Compound Name | (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 117267409 |
| Molecular Formula | C8H13ClO4S2 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C/C=C\CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13ClO4S2/c9-15(12,13)5-2-1-3-8-4-6-14(10,11)7-8/h1-2,8H,3-7H2/b2-1- |
| InChIKey | RNXUYKOTEQBVCM-UPHRSURJSA-N |
| XLogP | 0.94 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|