(Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride

C8H13ClO4S2 — CID 117267409

IUPAC(Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C/C=C\CC1CCS(=O)(=O)C1
InChIInChI=1S/C8H13ClO4S2/c9-15(12,13)5-2-1-3-8-4-6-14(10,11)7-8/h1-2,8H,3-7H2/b2-1-
InChIKeyRNXUYKOTEQBVCM-UPHRSURJSA-N
MW272.77 g/mol
LogP0.94
Rot. Bonds4

About (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride

(Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride (PubChem CID 117267409) has the molecular formula C8H13ClO4S2 and a molecular weight of 272.77 g/mol. Its IUPAC name is (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride.

Molecular Properties

Compound Name(Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride
PubChem CID117267409
Molecular FormulaC8H13ClO4S2
Molecular Weight272.77 g/mol
Exact Mass271.99
IUPAC Name(Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C/C=C\CC1CCS(=O)(=O)C1
InChIInChI=1S/C8H13ClO4S2/c9-15(12,13)5-2-1-3-8-4-6-14(10,11)7-8/h1-2,8H,3-7H2/b2-1-
InChIKeyRNXUYKOTEQBVCM-UPHRSURJSA-N
XLogP0.94
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.77
LogP ≤ 50.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride?
The IUPAC name of (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride (CID 117267409) is (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride.
What is the SMILES notation for (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride?
The canonical SMILES for (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride is O=S(=O)(Cl)C/C=C\CC1CCS(=O)(=O)C1.
What is the InChIKey of (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride?
The InChIKey is RNXUYKOTEQBVCM-UPHRSURJSA-N. The full InChI is InChI=1S/C8H13ClO4S2/c9-15(12,13)5-2-1-3-8-4-6-14(10,11)7-8/h1-2,8H,3-7H2/b2-1-.
What are the key properties of (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride?
(Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride has a molecular weight of 272.77 g/mol, XLogP of 0.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(1,1-dioxothiolan-3-yl)but-2-ene-1-sulfonyl chloride is sourced from PubChem (CID 117267409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).