C12H16O4S2 — CID 139250136
(1E,8E)-6λ6,13λ6-dithiatricyclo[9.3.0.04,8]tetradeca-1,8-diene 6,6,13,13-tetraoxide (PubChem CID 139250136) has the molecular formula C12H16O4S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1E,8E)-6λ6,13λ6-dithiatricyclo[9.3.0.04,8]tetradeca-1,8-diene 6,6,13,13-tetraoxide.
| Compound Name | (1E,8E)-6λ6,13λ6-dithiatricyclo[9.3.0.04,8]tetradeca-1,8-diene 6,6,13,13-tetraoxide |
|---|---|
| PubChem CID | 139250136 |
| Molecular Formula | C12H16O4S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (1E,8E)-6λ6,13λ6-dithiatricyclo[9.3.0.04,8]tetradeca-1,8-diene 6,6,13,13-tetraoxide |
| SMILES | O=S1(=O)C/C2=C/CC3CS(=O)(=O)C/C3=C/CC2C1 |
| InChI | InChI=1S/C12H16O4S2/c13-17(14)5-9-1-2-10-6-18(15,16)8-12(10)4-3-11(9)7-17/h1,4,10-11H,2-3,5-8H2/b9-1-,12-4- |
| InChIKey | OKOSLGSTHSSJCK-XJGKRTTDSA-N |
| XLogP | 0.72 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|