C14H20O4S2 — CID 139250137
(1E,8E)-2,9-dimethyl-6λ6,13λ6-dithiatricyclo[9.3.0.04,8]tetradeca-1,8-diene 6,6,13,13-tetraoxide (PubChem CID 139250137) has the molecular formula C14H20O4S2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1E,8E)-2,9-dimethyl-6λ6,13λ6-dithiatricyclo[9.3.0.04,8]tetradeca-1,8-diene 6,6,13,13-tetraoxide.
| Compound Name | (1E,8E)-2,9-dimethyl-6λ6,13λ6-dithiatricyclo[9.3.0.04,8]tetradeca-1,8-diene 6,6,13,13-tetraoxide |
|---|---|
| PubChem CID | 139250137 |
| Molecular Formula | C14H20O4S2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (1E,8E)-2,9-dimethyl-6λ6,13λ6-dithiatricyclo[9.3.0.04,8]tetradeca-1,8-diene 6,6,13,13-tetraoxide |
| SMILES | C/C1=C2\CS(=O)(=O)CC2C/C(C)=C2/CS(=O)(=O)CC2C1 |
| InChI | InChI=1S/C14H20O4S2/c1-9-3-11-5-20(17,18)8-14(11)10(2)4-12-6-19(15,16)7-13(9)12/h11-12H,3-8H2,1-2H3/b13-9-,14-10- |
| InChIKey | YVFGUMCYBZPRMX-FOIMCPNXSA-N |
| XLogP | 1.50 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|