C12H22N2O2S — CID 117269273
3-[(Z)-4-piperazin-1-ylbut-2-enyl]thiolane 1,1-dioxide (PubChem CID 117269273) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 3-[(Z)-4-piperazin-1-ylbut-2-enyl]thiolane 1,1-dioxide.
| Compound Name | 3-[(Z)-4-piperazin-1-ylbut-2-enyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117269273 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-[(Z)-4-piperazin-1-ylbut-2-enyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C/C=C\CN2CCNCC2)C1 |
| InChI | InChI=1S/C12H22N2O2S/c15-17(16)10-4-12(11-17)3-1-2-7-14-8-5-13-6-9-14/h1-2,12-13H,3-11H2/b2-1- |
| InChIKey | ULAOYGOXKNNFRI-UPHRSURJSA-N |
| XLogP | 0.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|