About 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol
2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol (PubChem CID 117269769) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol.
Molecular Properties
| Compound Name | 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol |
| PubChem CID | 117269769 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol |
| SMILES | CC1(C)CC(Cc2ccccc2O)CN1 |
| InChI | InChI=1S/C13H19NO/c1-13(2)8-10(9-14-13)7-11-5-3-4-6-12(11)15/h3-6,10,14-15H,7-9H2,1-2H3 |
| InChIKey | IFTZXABUUYZJHK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol?
The IUPAC name of 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol (CID 117269769) is 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol.
What is the SMILES notation for 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol?
The canonical SMILES for 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol is CC1(C)CC(Cc2ccccc2O)CN1.
What is the InChIKey of 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol?
The InChIKey is IFTZXABUUYZJHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-13(2)8-10(9-14-13)7-11-5-3-4-6-12(11)15/h3-6,10,14-15H,7-9H2,1-2H3.
What are the key properties of 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol?
2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol has a molecular weight of 205.30 g/mol, XLogP of 2.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,5-dimethylpyrrolidin-3-yl)methyl]phenol is sourced from PubChem (CID 117269769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).