C10H16O3 — CID 117273264
4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-5-carboxylic acid (PubChem CID 117273264) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-5-carboxylic acid.
| Compound Name | 4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 117273264 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-5-carboxylic acid |
| SMILES | CC1C(C(=O)O)CCC2OCCC21 |
| InChI | InChI=1S/C10H16O3/c1-6-7-4-5-13-9(7)3-2-8(6)10(11)12/h6-9H,2-5H2,1H3,(H,11,12) |
| InChIKey | XJCNDVIIPZYKCO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |