C8H11NO4 — CID 117273473
methyl 1-methyl-2,3-dioxopiperidine-4-carboxylate (PubChem CID 117273473) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is methyl 1-methyl-2,3-dioxopiperidine-4-carboxylate.
| Compound Name | methyl 1-methyl-2,3-dioxopiperidine-4-carboxylate |
|---|---|
| PubChem CID | 117273473 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | methyl 1-methyl-2,3-dioxopiperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C)C(=O)C1=O |
| InChI | InChI=1S/C8H11NO4/c1-9-4-3-5(8(12)13-2)6(10)7(9)11/h5H,3-4H2,1-2H3 |
| InChIKey | CMJNYUHDNNGFSX-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|