C17H21NO6 — CID 11727397
dimethyl (3E)-9-methylidene-12,13-dioxo-1-azabicyclo[8.2.1]tridec-3-ene-6,6-dicarboxylate (PubChem CID 11727397) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is dimethyl (3E)-9-methylidene-12,13-dioxo-1-azabicyclo[8.2.1]tridec-3-ene-6,6-dicarboxylate.
| Compound Name | dimethyl (3E)-9-methylidene-12,13-dioxo-1-azabicyclo[8.2.1]tridec-3-ene-6,6-dicarboxylate |
|---|---|
| PubChem CID | 11727397 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | dimethyl (3E)-9-methylidene-12,13-dioxo-1-azabicyclo[8.2.1]tridec-3-ene-6,6-dicarboxylate |
| SMILES | C=C1CCC(C(=O)OC)(C(=O)OC)C/C=C/CN2C(=O)CC1C2=O |
| InChI | InChI=1S/C17H21NO6/c1-11-6-8-17(15(21)23-2,16(22)24-3)7-4-5-9-18-13(19)10-12(11)14(18)20/h4-5,12H,1,6-10H2,2-3H3/b5-4+ |
| InChIKey | MALVLMRCCLVFTM-SNAWJCMRSA-N |
| XLogP | 0.99 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|