C16H21NO6 — CID 23244128
dimethyl 2-[(2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl)methyl]propanedioate (PubChem CID 23244128) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is dimethyl 2-[(2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl)methyl]propanedioate.
| Compound Name | dimethyl 2-[(2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 23244128 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | dimethyl 2-[(2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl)methyl]propanedioate |
| SMILES | COC(=O)C(CC1=C(C)CC2C(=O)N(C)C(=O)C2C1)C(=O)OC |
| InChI | InChI=1S/C16H21NO6/c1-8-5-10-11(14(19)17(2)13(10)18)6-9(8)7-12(15(20)22-3)16(21)23-4/h10-12H,5-7H2,1-4H3 |
| InChIKey | MAJCHFUBFWBMJT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|