C27H34N2O7 — CID 102371761
methyl 2-[[(3aS,7aR)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-2-[[(3aR,7aS)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-3-oxobutanoate (PubChem CID 102371761) has the molecular formula C27H34N2O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is methyl 2-[[(3aS,7aR)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-2-[[(3aR,7aS)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-3-oxobutanoate.
| Compound Name | methyl 2-[[(3aS,7aR)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-2-[[(3aR,7aS)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 102371761 |
| Molecular Formula | C27H34N2O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | methyl 2-[[(3aS,7aR)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-2-[[(3aR,7aS)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-3-oxobutanoate |
| SMILES | COC(=O)C(CC1=C(C)C[C@H]2C(=O)N(C)C(=O)[C@H]2C1)(CC1=C(C)C[C@@H]2C(=O)N(C)C(=O)[C@@H]2C1)C(C)=O |
| InChI | InChI=1S/C27H34N2O7/c1-13-7-18-20(24(33)28(4)22(18)31)9-16(13)11-27(15(3)30,26(35)36-6)12-17-10-21-19(8-14(17)2)23(32)29(5)25(21)34/h18-21H,7-12H2,1-6H3/t18-,19+,20+,21-,27? |
| InChIKey | SMIXNEBSISQFAA-LWICHICISA-N |
| XLogP | 2.20 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|