C27H34N2O6 — CID 102371759
(3aS,7aR)-5-[2-[[(3aR,7aS)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-2-acetyl-3-oxobutyl]-2,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 102371759) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is (3aS,7aR)-5-[2-[[(3aR,7aS)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-2-acetyl-3-oxobutyl]-2,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-5-[2-[[(3aR,7aS)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-2-acetyl-3-oxobutyl]-2,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 102371759 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | (3aS,7aR)-5-[2-[[(3aR,7aS)-2,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-5-yl]methyl]-2-acetyl-3-oxobutyl]-2,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(=O)C(CC1=C(C)C[C@H]2C(=O)N(C)C(=O)[C@H]2C1)(CC1=C(C)C[C@@H]2C(=O)N(C)C(=O)[C@@H]2C1)C(C)=O |
| InChI | InChI=1S/C27H34N2O6/c1-13-7-19-21(25(34)28(5)23(19)32)9-17(13)11-27(15(3)30,16(4)31)12-18-10-22-20(8-14(18)2)24(33)29(6)26(22)35/h19-22H,7-12H2,1-6H3/t19-,20+,21+,22- |
| InChIKey | WDVTWBGVMYJPMT-ZDNVTZCJSA-N |
| XLogP | 2.61 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|