C22H33NO6Si — CID 11812141
dimethyl (3aR,8S,8aS)-2-methyl-1,3-dioxo-8-triethylsilyl-3a,4,5,7,8,8a-hexahydrocyclopenta[f]isoindole-6,6-dicarboxylate (PubChem CID 11812141) has the molecular formula C22H33NO6Si and a molecular weight of 435.59 g/mol. Its IUPAC name is dimethyl (3aR,8S,8aS)-2-methyl-1,3-dioxo-8-triethylsilyl-3a,4,5,7,8,8a-hexahydrocyclopenta[f]isoindole-6,6-dicarboxylate.
| Compound Name | dimethyl (3aR,8S,8aS)-2-methyl-1,3-dioxo-8-triethylsilyl-3a,4,5,7,8,8a-hexahydrocyclopenta[f]isoindole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 11812141 |
| Molecular Formula | C22H33NO6Si |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | dimethyl (3aR,8S,8aS)-2-methyl-1,3-dioxo-8-triethylsilyl-3a,4,5,7,8,8a-hexahydrocyclopenta[f]isoindole-6,6-dicarboxylate |
| SMILES | CC[Si](CC)(CC)[C@@H]1C2=C(C[C@H]3C(=O)N(C)C(=O)[C@@H]13)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C22H33NO6Si/c1-7-30(8-2,9-3)17-15-12-22(20(26)28-5,21(27)29-6)11-13(15)10-14-16(17)19(25)23(4)18(14)24/h14,16-17H,7-12H2,1-6H3/t14-,16-,17-/m1/s1 |
| InChIKey | RMSBLPQDRJLHQL-DJIMGWMZSA-N |
| XLogP | 2.92 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|