C31H47NO10Si — CID 11006657
tetraethyl (3aS,4S,9aR)-2-methyl-1,3-dioxo-4-triethylsilyl-3a,4,5,8,9,9a-hexahydrobenzo[f]isoindole-6,6,7,7-tetracarboxylate (PubChem CID 11006657) has the molecular formula C31H47NO10Si and a molecular weight of 621.80 g/mol. Its IUPAC name is tetraethyl (3aS,4S,9aR)-2-methyl-1,3-dioxo-4-triethylsilyl-3a,4,5,8,9,9a-hexahydrobenzo[f]isoindole-6,6,7,7-tetracarboxylate.
| Compound Name | tetraethyl (3aS,4S,9aR)-2-methyl-1,3-dioxo-4-triethylsilyl-3a,4,5,8,9,9a-hexahydrobenzo[f]isoindole-6,6,7,7-tetracarboxylate |
|---|---|
| PubChem CID | 11006657 |
| Molecular Formula | C31H47NO10Si |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | tetraethyl (3aS,4S,9aR)-2-methyl-1,3-dioxo-4-triethylsilyl-3a,4,5,8,9,9a-hexahydrobenzo[f]isoindole-6,6,7,7-tetracarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(CC1(C(=O)OCC)C(=O)OCC)[C@@H]([Si](CC)(CC)CC)[C@@H]1C(=O)N(C)C(=O)[C@@H]1C2 |
| InChI | InChI=1S/C31H47NO10Si/c1-9-39-26(35)30(27(36)40-10-2)17-19-16-20-22(25(34)32(8)24(20)33)23(43(13-5,14-6)15-7)21(19)18-31(30,28(37)41-11-3)29(38)42-12-4/h20,22-23H,9-18H2,1-8H3/t20-,22-,23-/m1/s1 |
| InChIKey | WWHDQIJCNRAKSM-YMPZKCBVSA-N |
| XLogP | 3.82 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|