C25H39NO6Si — CID 11733501
dimethyl (3aR,8S,8aS)-2-tert-butyl-1,3-dioxo-8-triethylsilyl-3a,4,5,7,8,8a-hexahydrocyclopenta[f]isoindole-6,6-dicarboxylate (PubChem CID 11733501) has the molecular formula C25H39NO6Si and a molecular weight of 477.67 g/mol. Its IUPAC name is dimethyl (3aR,8S,8aS)-2-tert-butyl-1,3-dioxo-8-triethylsilyl-3a,4,5,7,8,8a-hexahydrocyclopenta[f]isoindole-6,6-dicarboxylate.
| Compound Name | dimethyl (3aR,8S,8aS)-2-tert-butyl-1,3-dioxo-8-triethylsilyl-3a,4,5,7,8,8a-hexahydrocyclopenta[f]isoindole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 11733501 |
| Molecular Formula | C25H39NO6Si |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | dimethyl (3aR,8S,8aS)-2-tert-butyl-1,3-dioxo-8-triethylsilyl-3a,4,5,7,8,8a-hexahydrocyclopenta[f]isoindole-6,6-dicarboxylate |
| SMILES | CC[Si](CC)(CC)[C@@H]1C2=C(C[C@H]3C(=O)N(C(C)(C)C)C(=O)[C@@H]13)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C25H39NO6Si/c1-9-33(10-2,11-3)19-17-14-25(22(29)31-7,23(30)32-8)13-15(17)12-16-18(19)21(28)26(20(16)27)24(4,5)6/h16,18-19H,9-14H2,1-8H3/t16-,18-,19-/m1/s1 |
| InChIKey | RRQXWHBOIMEVFQ-BHIYHBOVSA-N |
| XLogP | 4.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|