C27H39NO10Si — CID 102573011
tetramethyl (3aS,4S,9aR)-2-methyl-1,3-dioxo-4-triethylsilyl-3a,4,5,8,9,9a-hexahydrobenzo[f]isoindole-6,6,7,7-tetracarboxylate (PubChem CID 102573011) has the molecular formula C27H39NO10Si and a molecular weight of 565.69 g/mol. Its IUPAC name is tetramethyl (3aS,4S,9aR)-2-methyl-1,3-dioxo-4-triethylsilyl-3a,4,5,8,9,9a-hexahydrobenzo[f]isoindole-6,6,7,7-tetracarboxylate.
| Compound Name | tetramethyl (3aS,4S,9aR)-2-methyl-1,3-dioxo-4-triethylsilyl-3a,4,5,8,9,9a-hexahydrobenzo[f]isoindole-6,6,7,7-tetracarboxylate |
|---|---|
| PubChem CID | 102573011 |
| Molecular Formula | C27H39NO10Si |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | tetramethyl (3aS,4S,9aR)-2-methyl-1,3-dioxo-4-triethylsilyl-3a,4,5,8,9,9a-hexahydrobenzo[f]isoindole-6,6,7,7-tetracarboxylate |
| SMILES | CC[Si](CC)(CC)[C@@H]1C2=C(C[C@H]3C(=O)N(C)C(=O)[C@@H]13)CC(C(=O)OC)(C(=O)OC)C(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C27H39NO10Si/c1-9-39(10-2,11-3)19-17-14-27(24(33)37-7,25(34)38-8)26(22(31)35-5,23(32)36-6)13-15(17)12-16-18(19)21(30)28(4)20(16)29/h16,18-19H,9-14H2,1-8H3/t16-,18-,19-/m1/s1 |
| InChIKey | WBLXLAIBGDGTEV-BHIYHBOVSA-N |
| XLogP | 2.26 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|