C21H27NO6 — CID 135013714
dimethyl (3aS,10aS,10bR)-2-ethyl-5,6-dimethyl-1,3-dioxo-3a,4,8,10,10a,10b-hexahydrocyclohepta[e]isoindole-9,9-dicarboxylate (PubChem CID 135013714) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is dimethyl (3aS,10aS,10bR)-2-ethyl-5,6-dimethyl-1,3-dioxo-3a,4,8,10,10a,10b-hexahydrocyclohepta[e]isoindole-9,9-dicarboxylate.
| Compound Name | dimethyl (3aS,10aS,10bR)-2-ethyl-5,6-dimethyl-1,3-dioxo-3a,4,8,10,10a,10b-hexahydrocyclohepta[e]isoindole-9,9-dicarboxylate |
|---|---|
| PubChem CID | 135013714 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | dimethyl (3aS,10aS,10bR)-2-ethyl-5,6-dimethyl-1,3-dioxo-3a,4,8,10,10a,10b-hexahydrocyclohepta[e]isoindole-9,9-dicarboxylate |
| SMILES | CCN1C(=O)[C@H]2[C@H](CC(C)=C3C(C)=CCC(C(=O)OC)(C(=O)OC)C[C@H]32)C1=O |
| InChI | InChI=1S/C21H27NO6/c1-6-22-17(23)13-9-12(3)15-11(2)7-8-21(19(25)27-4,20(26)28-5)10-14(15)16(13)18(22)24/h7,13-14,16H,6,8-10H2,1-5H3/t13-,14+,16-/m0/s1 |
| InChIKey | GUPLYJTWMUMHET-LZWOXQAQSA-N |
| XLogP | 2.02 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|