C20H34O4 — CID 11727490
[(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] 2,2-dimethylpropanoate (PubChem CID 11727490) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is [(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11727490 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\COC1CCCCO1)CC/C=C(\C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H34O4/c1-16(12-14-23-18-11-6-7-13-22-18)9-8-10-17(2)15-24-19(21)20(3,4)5/h10,12,18H,6-9,11,13-15H2,1-5H3/b16-12+,17-10+ |
| InChIKey | RWVTUNIQJXAPKN-VMHPKHSQSA-N |
| XLogP | 4.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|