C10H14O3 — CID 117279140
3-(3-hydroxypropyl)-6-methylbenzene-1,2-diol (PubChem CID 117279140) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-6-methylbenzene-1,2-diol.
| Compound Name | 3-(3-hydroxypropyl)-6-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 117279140 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-(3-hydroxypropyl)-6-methylbenzene-1,2-diol |
| SMILES | Cc1ccc(CCCO)c(O)c1O |
| InChI | InChI=1S/C10H14O3/c1-7-4-5-8(3-2-6-11)10(13)9(7)12/h4-5,11-13H,2-3,6H2,1H3 |
| InChIKey | HZHBNPQYJDKKGK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|