C11H11N3 — CID 117280247
2-(1-methyl-4,5-dihydroimidazol-2-yl)benzonitrile (PubChem CID 117280247) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-(1-methyl-4,5-dihydroimidazol-2-yl)benzonitrile.
| Compound Name | 2-(1-methyl-4,5-dihydroimidazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 117280247 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(1-methyl-4,5-dihydroimidazol-2-yl)benzonitrile |
| SMILES | CN1CCN=C1c1ccccc1C#N |
| InChI | InChI=1S/C11H11N3/c1-14-7-6-13-11(14)10-5-3-2-4-9(10)8-12/h2-5H,6-7H2,1H3 |
| InChIKey | FKOLZZXHGKGXBR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |