C13H10ClN — CID 144960959
2-(6-chlorocyclohexa-1,5-dien-1-yl)benzonitrile (PubChem CID 144960959) has the molecular formula C13H10ClN and a molecular weight of 215.68 g/mol. Its IUPAC name is 2-(6-chlorocyclohexa-1,5-dien-1-yl)benzonitrile.
| Compound Name | 2-(6-chlorocyclohexa-1,5-dien-1-yl)benzonitrile |
|---|---|
| PubChem CID | 144960959 |
| Molecular Formula | C13H10ClN |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-(6-chlorocyclohexa-1,5-dien-1-yl)benzonitrile |
| SMILES | N#Cc1ccccc1C1=CCCC=C1Cl |
| InChI | InChI=1S/C13H10ClN/c14-13-8-4-3-7-12(13)11-6-2-1-5-10(11)9-15/h1-2,5-8H,3-4H2 |
| InChIKey | WMMSXWFZPWVHKB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |