C11H5Cl2NS — CID 125483376
2-(2,5-dichlorothiophen-3-yl)benzonitrile (PubChem CID 125483376) has the molecular formula C11H5Cl2NS and a molecular weight of 254.14 g/mol. Its IUPAC name is 2-(2,5-dichlorothiophen-3-yl)benzonitrile.
| Compound Name | 2-(2,5-dichlorothiophen-3-yl)benzonitrile |
|---|---|
| PubChem CID | 125483376 |
| Molecular Formula | C11H5Cl2NS |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 2-(2,5-dichlorothiophen-3-yl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H5Cl2NS/c12-10-5-9(11(13)15-10)8-4-2-1-3-7(8)6-14/h1-5H |
| InChIKey | MPYVBUYOJHBLCS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |