C12H10N2O2 — CID 134500411
3-(2-cyanophenyl)-2,5-dihydropyrrole-1-carboxylic acid (PubChem CID 134500411) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-(2-cyanophenyl)-2,5-dihydropyrrole-1-carboxylic acid.
| Compound Name | 3-(2-cyanophenyl)-2,5-dihydropyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 134500411 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-(2-cyanophenyl)-2,5-dihydropyrrole-1-carboxylic acid |
| SMILES | N#Cc1ccccc1C1=CCN(C(=O)O)C1 |
| InChI | InChI=1S/C12H10N2O2/c13-7-9-3-1-2-4-11(9)10-5-6-14(8-10)12(15)16/h1-5H,6,8H2,(H,15,16) |
| InChIKey | LQFBVZLEIOGYJP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |