C21H34N2O3 — CID 11728169
1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[(2S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]methanimine (PubChem CID 11728169) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[(2S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]methanimine.
| Compound Name | 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[(2S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]methanimine |
|---|---|
| PubChem CID | 11728169 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[(2S)-3-methyl-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]methanimine |
| SMILES | COc1cc2c(cc1OC)CN(/C=N/[C@H](COC(C)(C)C)C(C)C)CC2 |
| InChI | InChI=1S/C21H34N2O3/c1-15(2)18(13-26-21(3,4)5)22-14-23-9-8-16-10-19(24-6)20(25-7)11-17(16)12-23/h10-11,14-15,18H,8-9,12-13H2,1-7H3/b22-14+/t18-/m1/s1 |
| InChIKey | BODFJJUURHGGQT-SDLXJUDFSA-N |
| XLogP | 3.93 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|