C17H26N2O — CID 15004265
1-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]methanimine (PubChem CID 15004265) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]methanimine.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]methanimine |
|---|---|
| PubChem CID | 15004265 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]methanimine |
| SMILES | COC[C@@H](/N=C/N1CCc2ccccc2C1)C(C)(C)C |
| InChI | InChI=1S/C17H26N2O/c1-17(2,3)16(12-20-4)18-13-19-10-9-14-7-5-6-8-15(14)11-19/h5-8,13,16H,9-12H2,1-4H3/b18-13+/t16-/m1/s1 |
| InChIKey | FDYMUSDYWPDOED-APVMCDBPSA-N |
| XLogP | 3.13 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|