C12H18N2 — CID 117282062
2-[(E)-3-aminoprop-1-enyl]-N,N,4-trimethylaniline (PubChem CID 117282062) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-[(E)-3-aminoprop-1-enyl]-N,N,4-trimethylaniline.
| Compound Name | 2-[(E)-3-aminoprop-1-enyl]-N,N,4-trimethylaniline |
|---|---|
| PubChem CID | 117282062 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2-[(E)-3-aminoprop-1-enyl]-N,N,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)C)c(/C=C/CN)c1 |
| InChI | InChI=1S/C12H18N2/c1-10-6-7-12(14(2)3)11(9-10)5-4-8-13/h4-7,9H,8,13H2,1-3H3/b5-4+ |
| InChIKey | OJSAMIFXLULCIM-SNAWJCMRSA-N |
| XLogP | 2.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |