C12H14FN — CID 117282442
(E)-3-(4-cyclopropyl-3-fluorophenyl)prop-2-en-1-amine (PubChem CID 117282442) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is (E)-3-(4-cyclopropyl-3-fluorophenyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(4-cyclopropyl-3-fluorophenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117282442 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (E)-3-(4-cyclopropyl-3-fluorophenyl)prop-2-en-1-amine |
| SMILES | NC/C=C/c1ccc(C2CC2)c(F)c1 |
| InChI | InChI=1S/C12H14FN/c13-12-8-9(2-1-7-14)3-6-11(12)10-4-5-10/h1-3,6,8,10H,4-5,7,14H2/b2-1+ |
| InChIKey | YVPGHOSWNQTZIR-OWOJBTEDSA-N |
| XLogP | 2.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |