C20H26F3NO2 — CID 11728352
3,3,3-trifluoro-2-hydroxy-2-(4-methylphenyl)-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propanamide (PubChem CID 11728352) has the molecular formula C20H26F3NO2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-2-(4-methylphenyl)-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propanamide.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-2-(4-methylphenyl)-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propanamide |
|---|---|
| PubChem CID | 11728352 |
| Molecular Formula | C20H26F3NO2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-2-(4-methylphenyl)-N-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propanamide |
| SMILES | Cc1ccc(C(O)(C(=O)N[C@@H]2C[C@H]3CC[C@]2(C)C3(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H26F3NO2/c1-12-5-7-13(8-6-12)19(26,20(21,22)23)16(25)24-15-11-14-9-10-18(15,4)17(14,2)3/h5-8,14-15,26H,9-11H2,1-4H3,(H,24,25)/t14-,15-,18+,19?/m1/s1 |
| InChIKey | PBBMRTRQPNHZFJ-KDVHSSIJSA-N |
| XLogP | 4.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |