C22H21FN4O3S — CID 1172846
ethyl 4-amino-2-[2-(N-benzyl-4-fluoroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 1172846) has the molecular formula C22H21FN4O3S and a molecular weight of 440.50 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-(N-benzyl-4-fluoroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-(N-benzyl-4-fluoroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 1172846 |
| Molecular Formula | C22H21FN4O3S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | ethyl 4-amino-2-[2-(N-benzyl-4-fluoroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)N(Cc2ccccc2)c2ccc(F)cc2)nc1N |
| InChI | InChI=1S/C22H21FN4O3S/c1-2-30-21(29)18-12-25-22(26-20(18)24)31-14-19(28)27(13-15-6-4-3-5-7-15)17-10-8-16(23)9-11-17/h3-12H,2,13-14H2,1H3,(H2,24,25,26) |
| InChIKey | DDIMJCKQEMALBZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |