C10H9FO3 — CID 117285919
2-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)acetic acid (PubChem CID 117285919) has the molecular formula C10H9FO3 and a molecular weight of 196.18 g/mol. Its IUPAC name is 2-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)acetic acid.
| Compound Name | 2-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)acetic acid |
|---|---|
| PubChem CID | 117285919 |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 2-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)acetic acid |
| SMILES | O=C(O)Cc1c(F)ccc2c1CCO2 |
| InChI | InChI=1S/C10H9FO3/c11-8-1-2-9-6(3-4-14-9)7(8)5-10(12)13/h1-2H,3-5H2,(H,12,13) |
| InChIKey | HAYXQTNPCLHMLG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |