C11H11FO3 — CID 117299962
3-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanoic acid (PubChem CID 117299962) has the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. Its IUPAC name is 3-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanoic acid.
| Compound Name | 3-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanoic acid |
|---|---|
| PubChem CID | 117299962 |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 3-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanoic acid |
| SMILES | O=C(O)CCc1c(F)ccc2c1CCO2 |
| InChI | InChI=1S/C11H11FO3/c12-9-2-3-10-8(5-6-15-10)7(9)1-4-11(13)14/h2-3H,1,4-6H2,(H,13,14) |
| InChIKey | FEGSMRCIPWDCDV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |