C13H12O4 — CID 163510988
3-(7,8-dihydrofuro[3,2-e][1]benzofuran-1-yl)propanoic acid (PubChem CID 163510988) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-(7,8-dihydrofuro[3,2-e][1]benzofuran-1-yl)propanoic acid.
| Compound Name | 3-(7,8-dihydrofuro[3,2-e][1]benzofuran-1-yl)propanoic acid |
|---|---|
| PubChem CID | 163510988 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-(7,8-dihydrofuro[3,2-e][1]benzofuran-1-yl)propanoic acid |
| SMILES | O=C(O)CCc1coc2ccc3c(c12)CCO3 |
| InChI | InChI=1S/C13H12O4/c14-12(15)4-1-8-7-17-11-3-2-10-9(13(8)11)5-6-16-10/h2-3,7H,1,4-6H2,(H,14,15) |
| InChIKey | DCQVXZROWNCCRG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |