C12H13FO4 — CID 117352753
4-(6-fluoro-4H-1,3-benzodioxin-5-yl)butanoic acid (PubChem CID 117352753) has the molecular formula C12H13FO4 and a molecular weight of 240.23 g/mol. Its IUPAC name is 4-(6-fluoro-4H-1,3-benzodioxin-5-yl)butanoic acid.
| Compound Name | 4-(6-fluoro-4H-1,3-benzodioxin-5-yl)butanoic acid |
|---|---|
| PubChem CID | 117352753 |
| Molecular Formula | C12H13FO4 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 4-(6-fluoro-4H-1,3-benzodioxin-5-yl)butanoic acid |
| SMILES | O=C(O)CCCc1c(F)ccc2c1COCO2 |
| InChI | InChI=1S/C12H13FO4/c13-10-4-5-11-9(6-16-7-17-11)8(10)2-1-3-12(14)15/h4-5H,1-3,6-7H2,(H,14,15) |
| InChIKey | HYSNBVRBTFPHGT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |